About N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine
N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine (PubChem CID 88931790) has the molecular formula C7H5ClFN3
and a molecular weight of 185.59 g/mol. Its IUPAC name is N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine |
| PubChem CID | 88931790 |
| Molecular Formula | C7H5ClFN3 |
| Molecular Weight | 185.59 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine |
| SMILES | Fc1cnc(NCl)c2[nH]ccc12 |
| InChI | InChI=1S/C7H5ClFN3/c8-12-7-6-4(1-2-10-6)5(9)3-11-7/h1-3,10H,(H,11,12) |
| InChIKey | RKCPBNCOYSOZTR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.59 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine?
The IUPAC name of N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine (CID 88931790) is N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine.
What is the SMILES notation for N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine?
The canonical SMILES for N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine is Fc1cnc(NCl)c2[nH]ccc12.
What is the InChIKey of N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine?
The InChIKey is RKCPBNCOYSOZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClFN3/c8-12-7-6-4(1-2-10-6)5(9)3-11-7/h1-3,10H,(H,11,12).
What are the key properties of N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine?
N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine has a molecular weight of 185.59 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-7-amine is sourced from PubChem (CID 88931790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).