C10H4Cl2F3N3 — CID 79632308
2,5-dichloro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine (PubChem CID 79632308) has the molecular formula C10H4Cl2F3N3 and a molecular weight of 294.06 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79632308 |
| Molecular Formula | C10H4Cl2F3N3 |
| Molecular Weight | 294.06 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 2,5-dichloro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
| SMILES | Fc1cc(F)c(F)c(Nc2nc(Cl)ncc2Cl)c1 |
| InChI | InChI=1S/C10H4Cl2F3N3/c11-5-3-16-10(12)18-9(5)17-7-2-4(13)1-6(14)8(7)15/h1-3H,(H,16,17,18) |
| InChIKey | BRGQFGYVDZMLKE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|