C16H19N — CID 123250682
N-cycloocta-1,3,5-trien-1-ylcycloocta-3,5-dien-1-imine (PubChem CID 123250682) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is N-cycloocta-1,3,5-trien-1-ylcycloocta-3,5-dien-1-imine.
| Compound Name | N-cycloocta-1,3,5-trien-1-ylcycloocta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 123250682 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-cycloocta-1,3,5-trien-1-ylcycloocta-3,5-dien-1-imine |
| SMILES | C1=CC=C(/N=C2/CC=CC=CCC2)CCC=C1 |
| InChI | InChI=1S/C16H19N/c1-3-7-11-15(12-8-4-1)17-16-13-9-5-2-6-10-14-16/h1-7,9,11H,8,10,12-14H2/b4-1?,6-2?,7-3?,9-5?,15-11?,17-16- |
| InChIKey | ITVIYKNQIFTMMJ-VEVOOVBDSA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|