C38H34N4 — CID 155576892
2-cyclohepta-1,3-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-6-[4-(2,6-dimethyl-3-pyridinyl)phenyl]-1,3,5-triazine (PubChem CID 155576892) has the molecular formula C38H34N4 and a molecular weight of 546.72 g/mol. Its IUPAC name is 2-cyclohepta-1,3-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-6-[4-(2,6-dimethyl-3-pyridinyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-cyclohepta-1,3-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-6-[4-(2,6-dimethyl-3-pyridinyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 155576892 |
| Molecular Formula | C38H34N4 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 2-cyclohepta-1,3-dien-1-yl-4-(9,9-dimethylfluoren-2-yl)-6-[4-(2,6-dimethyl-3-pyridinyl)phenyl]-1,3,5-triazine |
| SMILES | Cc1ccc(-c2ccc(-c3nc(C4=CC=CCCC4)nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)n3)cc2)c(C)n1 |
| InChI | InChI=1S/C38H34N4/c1-24-15-21-30(25(2)39-24)26-16-18-28(19-17-26)36-40-35(27-11-7-5-6-8-12-27)41-37(42-36)29-20-22-32-31-13-9-10-14-33(31)38(3,4)34(32)23-29/h5,7,9-11,13-23H,6,8,12H2,1-4H3 |
| InChIKey | NXRPHMRVGVJHCG-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |