C22H22O — CID 89277097
4-[4-[(2R)-2-cyclohexa-1,3-dien-1-ylpropyl]phenyl]benzaldehyde (PubChem CID 89277097) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[4-[(2R)-2-cyclohexa-1,3-dien-1-ylpropyl]phenyl]benzaldehyde.
| Compound Name | 4-[4-[(2R)-2-cyclohexa-1,3-dien-1-ylpropyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 89277097 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-[4-[(2R)-2-cyclohexa-1,3-dien-1-ylpropyl]phenyl]benzaldehyde |
| SMILES | C[C@H](Cc1ccc(-c2ccc(C=O)cc2)cc1)C1=CC=CCC1 |
| InChI | InChI=1S/C22H22O/c1-17(20-5-3-2-4-6-20)15-18-7-11-21(12-8-18)22-13-9-19(16-23)10-14-22/h2-3,5,7-14,16-17H,4,6,15H2,1H3/t17-/m1/s1 |
| InChIKey | DAEQSWVYISQARL-QGZVFWFLSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|