About 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol
2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 123397571) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 123397571 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1CC=CC=C1C1=CC=CCC1O |
| InChI | InChI=1S/C12H14O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-6,11-14H,7-8H2 |
| InChIKey | RZDQCIJGBPOOCE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol (CID 123397571) is 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol is OC1CC=CC=C1C1=CC=CCC1O.
What is the InChIKey of 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol?
The InChIKey is RZDQCIJGBPOOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-6,11-14H,7-8H2.
What are the key properties of 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol?
2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol has a molecular weight of 190.24 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-hydroxycyclohexa-1,3-dien-1-yl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 123397571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).