C18H21BO2 — CID 143742417
ethane;(2-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 143742417) has the molecular formula C18H21BO2 and a molecular weight of 280.18 g/mol. Its IUPAC name is ethane;(2-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | ethane;(2-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 143742417 |
| Molecular Formula | C18H21BO2 |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | ethane;(2-naphthalen-1-ylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | CC.OB(O)C1CC=CC=C1c1cccc2ccccc12 |
| InChI | InChI=1S/C16H15BO2.C2H6/c18-17(19)16-11-4-3-9-15(16)14-10-5-7-12-6-1-2-8-13(12)14;1-2/h1-10,16,18-19H,11H2;1-2H3 |
| InChIKey | MQUWKJBJYOFEOB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|