C28H19NO2 — CID 149099582
17-(6-nitrocyclohexa-1,3-dien-1-yl)pentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14(22),15,17,19-undecaene (PubChem CID 149099582) has the molecular formula C28H19NO2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 17-(6-nitrocyclohexa-1,3-dien-1-yl)pentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14(22),15,17,19-undecaene.
| Compound Name | 17-(6-nitrocyclohexa-1,3-dien-1-yl)pentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14(22),15,17,19-undecaene |
|---|---|
| PubChem CID | 149099582 |
| Molecular Formula | C28H19NO2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 17-(6-nitrocyclohexa-1,3-dien-1-yl)pentacyclo[12.7.1.02,7.08,13.018,22]docosa-1(21),2,4,6,8,10,12,14(22),15,17,19-undecaene |
| SMILES | O=[N+]([O-])C1CC=CC=C1c1ccc2c3c(cccc13)-c1ccccc1-c1ccccc1-2 |
| InChI | InChI=1S/C28H19NO2/c30-29(31)27-15-6-5-12-23(27)22-16-17-26-21-11-4-2-9-19(21)18-8-1-3-10-20(18)24-13-7-14-25(22)28(24)26/h1-14,16-17,27H,15H2 |
| InChIKey | QUJHVLMBYZPOHK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|