About 3-nitrosofluoranthene
3-nitrosofluoranthene (PubChem CID 10036873) has the molecular formula C16H9NO
and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-nitrosofluoranthene.
Molecular Properties
| Compound Name | 3-nitrosofluoranthene |
| PubChem CID | 10036873 |
| Molecular Formula | C16H9NO |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-nitrosofluoranthene |
| SMILES | O=Nc1ccc2c3c(cccc13)-c1ccccc1-2 |
| InChI | InChI=1S/C16H9NO/c18-17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H |
| InChIKey | JDRWBGLXHBTXNY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-nitrosofluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrosofluoranthene?
The IUPAC name of 3-nitrosofluoranthene (CID 10036873) is 3-nitrosofluoranthene.
What is the SMILES notation for 3-nitrosofluoranthene?
The canonical SMILES for 3-nitrosofluoranthene is O=Nc1ccc2c3c(cccc13)-c1ccccc1-2.
What is the InChIKey of 3-nitrosofluoranthene?
The InChIKey is JDRWBGLXHBTXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO/c18-17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H.
What are the key properties of 3-nitrosofluoranthene?
3-nitrosofluoranthene has a molecular weight of 231.25 g/mol, XLogP of 4.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrosofluoranthene is sourced from PubChem (CID 10036873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).