C38H19Cl5N6 — CID 160640226
2,4-dichloro-6-fluoranthen-3-yl-1,3,5-triazine;fluoranthene;2,4,6-trichloro-1,3,5-triazine (PubChem CID 160640226) has the molecular formula C38H19Cl5N6 and a molecular weight of 736.88 g/mol. Its IUPAC name is 2,4-dichloro-6-fluoranthen-3-yl-1,3,5-triazine;fluoranthene;2,4,6-trichloro-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-fluoranthen-3-yl-1,3,5-triazine;fluoranthene;2,4,6-trichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 160640226 |
| Molecular Formula | C38H19Cl5N6 |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 734.01 |
| IUPAC Name | 2,4-dichloro-6-fluoranthen-3-yl-1,3,5-triazine;fluoranthene;2,4,6-trichloro-1,3,5-triazine |
| SMILES | Clc1nc(Cl)nc(-c2ccc3c4c(cccc24)-c2ccccc2-3)n1.Clc1nc(Cl)nc(Cl)n1.c1ccc2c(c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C19H9Cl2N3.C16H10.C3Cl3N3/c20-18-22-17(23-19(21)24-18)15-9-8-14-11-5-2-1-4-10(11)12-6-3-7-13(15)16(12)14;1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;4-1-7-2(5)9-3(6)8-1/h1-9H;1-10H; |
| InChIKey | RJBSRSRUBDVSAW-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |