C44H28N2 — CID 130355522
4-(3,5-diphenylphenyl)-2-fluoranthen-3-yl-6-phenylpyrimidine (PubChem CID 130355522) has the molecular formula C44H28N2 and a molecular weight of 584.72 g/mol. Its IUPAC name is 4-(3,5-diphenylphenyl)-2-fluoranthen-3-yl-6-phenylpyrimidine.
| Compound Name | 4-(3,5-diphenylphenyl)-2-fluoranthen-3-yl-6-phenylpyrimidine |
|---|---|
| PubChem CID | 130355522 |
| Molecular Formula | C44H28N2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 4-(3,5-diphenylphenyl)-2-fluoranthen-3-yl-6-phenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4ccccc4)nc(-c4ccc5c6c(cccc46)-c4ccccc4-5)n3)c2)cc1 |
| InChI | InChI=1S/C44H28N2/c1-4-13-29(14-5-1)32-25-33(30-15-6-2-7-16-30)27-34(26-32)42-28-41(31-17-8-3-9-18-31)45-44(46-42)40-24-23-39-36-20-11-10-19-35(36)37-21-12-22-38(40)43(37)39/h1-28H |
| InChIKey | AIDKWJCODLXZGG-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |