C35H21N5 — CID 130263791
2-[4-(2-fluoranthen-3-yl-6-phenylpyrimidin-4-yl)phenyl]-1,3,5-triazine (PubChem CID 130263791) has the molecular formula C35H21N5 and a molecular weight of 511.59 g/mol. Its IUPAC name is 2-[4-(2-fluoranthen-3-yl-6-phenylpyrimidin-4-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[4-(2-fluoranthen-3-yl-6-phenylpyrimidin-4-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130263791 |
| Molecular Formula | C35H21N5 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 2-[4-(2-fluoranthen-3-yl-6-phenylpyrimidin-4-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ncncn4)cc3)nc(-c3ccc4c5c(cccc35)-c3ccccc3-4)n2)cc1 |
| InChI | InChI=1S/C35H21N5/c1-2-7-22(8-3-1)31-19-32(23-13-15-24(16-14-23)34-37-20-36-21-38-34)40-35(39-31)30-18-17-29-26-10-5-4-9-25(26)27-11-6-12-28(30)33(27)29/h1-21H |
| InChIKey | IQAULWOWDFKADA-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |