C23H12Br2ClN3 — CID 129258763
2,4-bis(4-bromonaphthalen-1-yl)-6-chloro-1,3,5-triazine (PubChem CID 129258763) has the molecular formula C23H12Br2ClN3 and a molecular weight of 525.63 g/mol. Its IUPAC name is 2,4-bis(4-bromonaphthalen-1-yl)-6-chloro-1,3,5-triazine.
| Compound Name | 2,4-bis(4-bromonaphthalen-1-yl)-6-chloro-1,3,5-triazine |
|---|---|
| PubChem CID | 129258763 |
| Molecular Formula | C23H12Br2ClN3 |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 522.91 |
| IUPAC Name | 2,4-bis(4-bromonaphthalen-1-yl)-6-chloro-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccc(Br)c3ccccc23)nc(-c2ccc(Br)c3ccccc23)n1 |
| InChI | InChI=1S/C23H12Br2ClN3/c24-19-11-9-17(13-5-1-3-7-15(13)19)21-27-22(29-23(26)28-21)18-10-12-20(25)16-8-4-2-6-14(16)18/h1-12H |
| InChIKey | MQKWIYRDANKTLL-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |