C32H21BrN2 — CID 146481095
2-(4-bromonaphthalen-1-yl)-4-phenyl-6-(4-phenylphenyl)pyrimidine (PubChem CID 146481095) has the molecular formula C32H21BrN2 and a molecular weight of 513.44 g/mol. Its IUPAC name is 2-(4-bromonaphthalen-1-yl)-4-phenyl-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 2-(4-bromonaphthalen-1-yl)-4-phenyl-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 146481095 |
| Molecular Formula | C32H21BrN2 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 2-(4-bromonaphthalen-1-yl)-4-phenyl-6-(4-phenylphenyl)pyrimidine |
| SMILES | Brc1ccc(-c2nc(-c3ccccc3)cc(-c3ccc(-c4ccccc4)cc3)n2)c2ccccc12 |
| InChI | InChI=1S/C32H21BrN2/c33-29-20-19-28(26-13-7-8-14-27(26)29)32-34-30(24-11-5-2-6-12-24)21-31(35-32)25-17-15-23(16-18-25)22-9-3-1-4-10-22/h1-21H |
| InChIKey | ZFTIHISYUOTYBG-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |