C40H28O5 — CID 163784132
6-(9,10-dinaphthalen-1-yl-5,10a-dihydroanthracen-2-yl)benzene-1,2,3,4,5-pentol (PubChem CID 163784132) has the molecular formula C40H28O5 and a molecular weight of 588.66 g/mol. Its IUPAC name is 6-(9,10-dinaphthalen-1-yl-5,10a-dihydroanthracen-2-yl)benzene-1,2,3,4,5-pentol.
| Compound Name | 6-(9,10-dinaphthalen-1-yl-5,10a-dihydroanthracen-2-yl)benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 163784132 |
| Molecular Formula | C40H28O5 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 6-(9,10-dinaphthalen-1-yl-5,10a-dihydroanthracen-2-yl)benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2ccc3c(c2)=C(c2cccc4ccccc24)C2=CC=CCC2C=3c2cccc3ccccc23)c(O)c1O |
| InChI | InChI=1S/C40H28O5/c41-36-33(37(42)39(44)40(45)38(36)43)24-19-20-31-32(21-24)35(28-18-8-12-23-10-2-4-14-26(23)28)30-16-6-5-15-29(30)34(31)27-17-7-11-22-9-1-3-13-25(22)27/h1-14,16-21,29,41-45H,15H2 |
| InChIKey | MRBYHVJDNFFOJY-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|