C48H16F16 — CID 123923293
1,2,3,5,6,7,8,9,10,11,12-undecafluoro-4-[5-[10-(2,3,4,5,6-pentafluorophenyl)-1,9a-dihydroanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene (PubChem CID 123923293) has the molecular formula C48H16F16 and a molecular weight of 896.62 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,9,10,11,12-undecafluoro-4-[5-[10-(2,3,4,5,6-pentafluorophenyl)-1,9a-dihydroanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene.
| Compound Name | 1,2,3,5,6,7,8,9,10,11,12-undecafluoro-4-[5-[10-(2,3,4,5,6-pentafluorophenyl)-1,9a-dihydroanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene |
|---|---|
| PubChem CID | 123923293 |
| Molecular Formula | C48H16F16 |
| Molecular Weight | 896.62 g/mol |
| Exact Mass | 896.10 |
| IUPAC Name | 1,2,3,5,6,7,8,9,10,11,12-undecafluoro-4-[5-[10-(2,3,4,5,6-pentafluorophenyl)-1,9a-dihydroanthracen-9-yl]naphthalen-1-yl]benzo[a]anthracene |
| SMILES | Fc1c(F)c(F)c(C2=c3ccccc3=C(c3cccc4c(-c5c(F)c(F)c(F)c6c5c(F)c(F)c5c(F)c7c(F)c(F)c(F)c(F)c7c(F)c56)cccc34)C3CC=CC=C23)c(F)c1F |
| InChI | InChI=1S/C48H16F16/c49-33-28-27-26(36(52)38(54)30(28)34(50)32-31(33)41(57)44(60)45(61)42(32)58)25(35(51)43(59)37(27)53)18-14-6-11-15-16(18)12-5-13-17(15)23-19-7-1-3-9-21(19)24(22-10-4-2-8-20(22)23)29-39(55)46(62)48(64)47(63)40(29)56/h1-7,9-14,20H,8H2 |
| InChIKey | IWNDVDZUPPMIBU-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.62 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|