C60H36O18 — CID 163708749
8-[4-[3-naphthalen-1-yl-5-[3-(2,3,4,5,6,7,8,9,10-nonahydroxypyren-1-yl)phenyl]phenyl]phenyl]pyrene-1,2,3,4,5,6,7,9,10-nonol (PubChem CID 163708749) has the molecular formula C60H36O18 and a molecular weight of 1044.93 g/mol. Its IUPAC name is 8-[4-[3-naphthalen-1-yl-5-[3-(2,3,4,5,6,7,8,9,10-nonahydroxypyren-1-yl)phenyl]phenyl]phenyl]pyrene-1,2,3,4,5,6,7,9,10-nonol.
| Compound Name | 8-[4-[3-naphthalen-1-yl-5-[3-(2,3,4,5,6,7,8,9,10-nonahydroxypyren-1-yl)phenyl]phenyl]phenyl]pyrene-1,2,3,4,5,6,7,9,10-nonol |
|---|---|
| PubChem CID | 163708749 |
| Molecular Formula | C60H36O18 |
| Molecular Weight | 1044.93 g/mol |
| Exact Mass | 1044.19 |
| IUPAC Name | 8-[4-[3-naphthalen-1-yl-5-[3-(2,3,4,5,6,7,8,9,10-nonahydroxypyren-1-yl)phenyl]phenyl]phenyl]pyrene-1,2,3,4,5,6,7,9,10-nonol |
| SMILES | Oc1c(O)c2c(O)c(O)c3c(O)c(O)c(-c4ccc(-c5cc(-c6cccc(-c7c(O)c(O)c8c(O)c(O)c9c(O)c(O)c(O)c%10c(O)c(O)c7c8c9%10)c6)cc(-c6cccc7ccccc67)c5)cc4)c4c(O)c(O)c(c1O)c2c34 |
| InChI | InChI=1S/C60H36O18/c61-43-29(35-31-33-39(49(67)45(35)63)55(73)59(77)57(75)41(33)53(71)51(69)37(31)47(43)65)21-13-11-19(12-14-21)24-16-25(18-26(17-24)28-10-4-6-20-5-1-2-9-27(20)28)22-7-3-8-23(15-22)30-36-32-34-40(50(68)46(36)64)56(74)60(78)58(76)42(34)54(72)52(70)38(32)48(66)44(30)62/h1-18,61-78H |
| InChIKey | KHISOLNLGUXEDO-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 364.14 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.93 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|