C54H34O8 — CID 163934105
9-(3-benzo[c]phenanthren-5-ylphenyl)-10-(3-naphthalen-1-ylphenyl)anthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 163934105) has the molecular formula C54H34O8 and a molecular weight of 810.86 g/mol. Its IUPAC name is 9-(3-benzo[c]phenanthren-5-ylphenyl)-10-(3-naphthalen-1-ylphenyl)anthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-(3-benzo[c]phenanthren-5-ylphenyl)-10-(3-naphthalen-1-ylphenyl)anthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 163934105 |
| Molecular Formula | C54H34O8 |
| Molecular Weight | 810.86 g/mol |
| Exact Mass | 810.23 |
| IUPAC Name | 9-(3-benzo[c]phenanthren-5-ylphenyl)-10-(3-naphthalen-1-ylphenyl)anthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | Oc1c(O)c(O)c2c(-c3cccc(-c4cc5ccc6ccccc6c5c5ccccc45)c3)c3c(O)c(O)c(O)c(O)c3c(-c3cccc(-c4cccc5ccccc45)c3)c2c1O |
| InChI | InChI=1S/C54H34O8/c55-47-43-41(31-15-7-13-29(24-31)35-21-9-12-27-10-1-3-17-34(27)35)44-46(50(58)54(62)52(60)48(44)56)42(45(43)49(57)53(61)51(47)59)32-16-8-14-30(25-32)39-26-33-23-22-28-11-2-4-18-36(28)40(33)38-20-6-5-19-37(38)39/h1-26,55-62H |
| InChIKey | RLFBHQBEBYZJMM-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.86 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|