C44H28O8 — CID 170600421
9-(3-benzo[c]phenanthren-5-ylphenyl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 170600421) has the molecular formula C44H28O8 and a molecular weight of 684.70 g/mol. Its IUPAC name is 9-(3-benzo[c]phenanthren-5-ylphenyl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-(3-benzo[c]phenanthren-5-ylphenyl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 170600421 |
| Molecular Formula | C44H28O8 |
| Molecular Weight | 684.70 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 9-(3-benzo[c]phenanthren-5-ylphenyl)-10-phenylanthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | Oc1c(O)c(O)c2c(-c3cccc(-c4cc5ccc6ccccc6c5c5ccccc45)c3)c3c(O)c(O)c(O)c(O)c3c(-c3ccccc3)c2c1O |
| InChI | InChI=1S/C44H28O8/c45-37-33-31(22-10-2-1-3-11-22)34-36(40(48)44(52)42(50)38(34)46)32(35(33)39(47)43(51)41(37)49)24-13-8-12-23(19-24)29-20-25-18-17-21-9-4-5-14-26(21)30(25)28-16-7-6-15-27(28)29/h1-20,45-52H |
| InChIKey | DRZQYSNDKGMLLT-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.70 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|