About CID 168993874
CID 168993874 (PubChem CID 168993874) has the molecular formula C38H16B8
and a molecular weight of 559.04 g/mol.
Molecular Properties
| Compound Name | CID 168993874 |
| PubChem CID | 168993874 |
| Molecular Formula | C38H16B8 |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(-c3cc4ccc5ccccc5c4c4ccccc34)c3c([B])c([B])c([B])c([B])c3c(-c3ccccc3)c2c1[B] |
| InChI | InChI=1S/C38H16B8/c39-31-27-25(18-9-2-1-3-10-18)28-30(34(42)38(46)36(44)32(28)40)26(29(27)33(41)37(45)35(31)43)23-16-19-15-14-17-8-4-5-11-20(17)24(19)22-13-7-6-12-21(22)23/h1-16H |
| InChIKey | IPQLOFGAEJCTEV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 168993874 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168993874?
The IUPAC name of CID 168993874 (CID 168993874) is not available.
What is the SMILES notation for CID 168993874?
The canonical SMILES for CID 168993874 is [B]c1c([B])c([B])c2c(-c3cc4ccc5ccccc5c4c4ccccc34)c3c([B])c([B])c([B])c([B])c3c(-c3ccccc3)c2c1[B].
What is the InChIKey of CID 168993874?
The InChIKey is IPQLOFGAEJCTEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H16B8/c39-31-27-25(18-9-2-1-3-10-18)28-30(34(42)38(46)36(44)32(28)40)26(29(27)33(41)37(45)35(31)43)23-16-19-15-14-17-8-4-5-11-20(17)24(19)22-13-7-6-12-21(22)23/h1-16H.
What are the key properties of CID 168993874?
CID 168993874 has a molecular weight of 559.04 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168993874 is sourced from PubChem (CID 168993874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).