C48H22B8 — CID 170600467
CID 170600467 (PubChem CID 170600467) has the molecular formula C48H22B8 and a molecular weight of 685.20 g/mol.
| Compound Name | CID 170600467 |
|---|---|
| PubChem CID | 170600467 |
| Molecular Formula | C48H22B8 |
| Molecular Weight | 685.20 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(-c3cc4ccc5ccccc5c4c4ccccc34)c3c([B])c([B])c([B])c([B])c3c(-c3ccc(-c4ccccc4)c4ccccc34)c2c1[B] |
| InChI | InChI=1S/C48H22B8/c49-41-37-35(32-21-20-26(23-10-2-1-3-11-23)28-14-6-7-15-29(28)32)38-40(44(52)48(56)46(54)42(38)50)36(39(37)43(51)47(55)45(41)53)33-22-25-19-18-24-12-4-5-13-27(24)34(25)31-17-9-8-16-30(31)33/h1-22H |
| InChIKey | VWPYKHJCCPBVNE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|