C52H32 — CID 162703193
5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylnaphthalen-1-yl)anthracen-9-yl]benzo[c]phenanthrene (PubChem CID 162703193) has the molecular formula C52H32 and a molecular weight of 664.88 g/mol. Its IUPAC name is 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylnaphthalen-1-yl)anthracen-9-yl]benzo[c]phenanthrene.
| Compound Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylnaphthalen-1-yl)anthracen-9-yl]benzo[c]phenanthrene |
|---|---|
| PubChem CID | 162703193 |
| Molecular Formula | C52H32 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylnaphthalen-1-yl)anthracen-9-yl]benzo[c]phenanthrene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc4ccc5ccccc5c4c4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4ccc5ccccc5c4)c4ccccc34)c2c1[2H] |
| InChI | InChI=1S/C52H32/c1-2-15-35-31-36(27-25-33(35)13-1)38-29-30-48(41-18-6-5-17-40(38)41)51-44-21-9-11-23-46(44)52(47-24-12-10-22-45(47)51)49-32-37-28-26-34-14-3-4-16-39(34)50(37)43-20-8-7-19-42(43)49/h1-32H/i9D,10D,11D,12D,21D,22D,23D,24D |
| InChIKey | MSIOKJQIBHCFMO-ZXIUVAIHSA-N |
| XLogP | 14.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|