C38H24 — CID 162703183
5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]benzo[c]phenanthrene (PubChem CID 162703183) has the molecular formula C38H24 and a molecular weight of 493.69 g/mol. Its IUPAC name is 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]benzo[c]phenanthrene.
| Compound Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]benzo[c]phenanthrene |
|---|---|
| PubChem CID | 162703183 |
| Molecular Formula | C38H24 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]benzo[c]phenanthrene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cc4ccc5ccccc5c4c4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C38H24/c1-2-13-26(14-3-1)36-31-18-8-10-20-33(31)38(34-21-11-9-19-32(34)36)35-24-27-23-22-25-12-4-5-15-28(25)37(27)30-17-7-6-16-29(30)35/h1-24H/i1D,2D,3D,8D,9D,10D,11D,13D,14D,18D,19D,20D,21D |
| InChIKey | FMBUNZQPAWEWOO-FQEVVSQJSA-N |
| XLogP | 10.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|