C46H30 — CID 176646878
1,2,3,4,5,6,7,8-octadeuterio-9-[3-(7-naphthalen-1-ylnaphthalen-1-yl)phenyl]-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene (PubChem CID 176646878) has the molecular formula C46H30 and a molecular weight of 595.83 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[3-(7-naphthalen-1-ylnaphthalen-1-yl)phenyl]-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-(7-naphthalen-1-ylnaphthalen-1-yl)phenyl]-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene |
|---|---|
| PubChem CID | 176646878 |
| Molecular Formula | C46H30 |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.32 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-(7-naphthalen-1-ylnaphthalen-1-yl)phenyl]-10-(2,3,4,5,6-pentadeuteriophenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc(-c4cccc5ccc(-c6cccc7ccccc67)cc45)c3)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H30/c1-2-14-33(15-3-1)45-40-21-6-8-23-42(40)46(43-24-9-7-22-41(43)45)36-19-10-18-34(29-36)39-26-12-17-32-27-28-35(30-44(32)39)38-25-11-16-31-13-4-5-20-37(31)38/h1-30H/i1D,2D,3D,6D,7D,8D,9D,14D,15D,21D,22D,23D,24D |
| InChIKey | PWFJXSOVVVUZDW-HJISOPIUSA-N |
| XLogP | 12.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|