C40H26 — CID 167406715
1,2,3,4,5,6,7,8-octadeuterio-9-naphthalen-1-yl-10-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)anthracene (PubChem CID 167406715) has the molecular formula C40H26 and a molecular weight of 518.72 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-naphthalen-1-yl-10-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)anthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-naphthalen-1-yl-10-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)anthracene |
|---|---|
| PubChem CID | 167406715 |
| Molecular Formula | C40H26 |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-naphthalen-1-yl-10-(2,3,5,6-tetradeuterio-4-naphthalen-1-ylphenyl)anthracene |
| SMILES | [2H]c1c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c([2H])c1-c1cccc2ccccc12 |
| InChI | InChI=1S/C40H26/c1-3-15-31-27(11-1)13-9-21-32(31)29-23-25-30(26-24-29)39-35-17-5-7-19-37(35)40(38-20-8-6-18-36(38)39)34-22-10-14-28-12-2-4-16-33(28)34/h1-26H/i5D,6D,7D,8D,17D,18D,19D,20D,23D,24D,25D,26D |
| InChIKey | OTZMTCVBRRUXDQ-BWYGNFRRSA-N |
| XLogP | 11.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|