C34H22 — CID 177089183
1,2,3,4,5,6,7,8-octadeuterio-9-phenanthren-1-yl-10-phenylanthracene (PubChem CID 177089183) has the molecular formula C34H22 and a molecular weight of 438.60 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-phenanthren-1-yl-10-phenylanthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-phenanthren-1-yl-10-phenylanthracene |
|---|---|
| PubChem CID | 177089183 |
| Molecular Formula | C34H22 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-phenanthren-1-yl-10-phenylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4c3ccc3ccccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C34H22/c1-2-12-24(13-3-1)33-29-15-6-8-17-31(29)34(32-18-9-7-16-30(32)33)28-20-10-19-26-25-14-5-4-11-23(25)21-22-27(26)28/h1-22H/i6D,7D,8D,9D,15D,16D,17D,18D |
| InChIKey | PYMKWHLAGVMQFT-SEUGGBKUSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|