C52H34 — CID 177108233
1,2,3,4,5,6,7,8-octadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-10-(4-phenanthren-1-yl-2,6-diphenylphenyl)anthracene (PubChem CID 177108233) has the molecular formula C52H34 and a molecular weight of 671.92 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-10-(4-phenanthren-1-yl-2,6-diphenylphenyl)anthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-10-(4-phenanthren-1-yl-2,6-diphenylphenyl)anthracene |
|---|---|
| PubChem CID | 177108233 |
| Molecular Formula | C52H34 |
| Molecular Weight | 671.92 g/mol |
| Exact Mass | 671.35 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-10-(4-phenanthren-1-yl-2,6-diphenylphenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3c(-c4ccccc4)cc(-c4cccc5c4ccc4ccccc45)cc3-c3ccccc3)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C52H34/c1-4-17-35(18-5-1)48-33-39(41-29-16-30-42-40-24-11-10-21-37(40)31-32-43(41)42)34-49(36-19-6-2-7-20-36)52(48)51-46-27-14-12-25-44(46)50(38-22-8-3-9-23-38)45-26-13-15-28-47(45)51/h1-34H/i3D,8D,9D,12D,13D,14D,15D,22D,23D,25D,26D,27D,28D |
| InChIKey | OVIXSHJWNGMIGH-ZTFJPSRRSA-N |
| XLogP | 14.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.92 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|