C40H26 — CID 176726930
1,2,3,4,5,6,7,8-octadeuterio-9-(3,4-dideuteriophenyl)-10-(5-naphthalen-2-ylnaphthalen-1-yl)anthracene (PubChem CID 176726930) has the molecular formula C40H26 and a molecular weight of 516.71 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-(3,4-dideuteriophenyl)-10-(5-naphthalen-2-ylnaphthalen-1-yl)anthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-(3,4-dideuteriophenyl)-10-(5-naphthalen-2-ylnaphthalen-1-yl)anthracene |
|---|---|
| PubChem CID | 176726930 |
| Molecular Formula | C40H26 |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-(3,4-dideuteriophenyl)-10-(5-naphthalen-2-ylnaphthalen-1-yl)anthracene |
| SMILES | [2H]c1ccc(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc4c(-c5ccc6ccccc6c5)cccc34)c3c([2H])c([2H])c([2H])c([2H])c23)cc1[2H] |
| InChI | InChI=1S/C40H26/c1-2-13-28(14-3-1)39-35-16-6-8-18-37(35)40(38-19-9-7-17-36(38)39)34-23-11-21-32-31(20-10-22-33(32)34)30-25-24-27-12-4-5-15-29(27)26-30/h1-26H/i1D,2D,6D,7D,8D,9D,16D,17D,18D,19D |
| InChIKey | CEAKSDJPFOXOFY-SRFGLDILSA-N |
| XLogP | 11.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|