C42H28 — CID 156624963
1,2,3,4,5,6,7,8-octadeuterio-9-(3-naphthalen-2-ylphenyl)-10-(4-phenylphenyl)anthracene (PubChem CID 156624963) has the molecular formula C42H28 and a molecular weight of 540.73 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-(3-naphthalen-2-ylphenyl)-10-(4-phenylphenyl)anthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-(3-naphthalen-2-ylphenyl)-10-(4-phenylphenyl)anthracene |
|---|---|
| PubChem CID | 156624963 |
| Molecular Formula | C42H28 |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-(3-naphthalen-2-ylphenyl)-10-(4-phenylphenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-c4ccc5ccccc5c4)c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4ccccc4)cc3)c2c1[2H] |
| InChI | InChI=1S/C42H28/c1-2-11-29(12-3-1)31-21-24-32(25-22-31)41-37-17-6-8-19-39(37)42(40-20-9-7-18-38(40)41)36-16-10-15-34(28-36)35-26-23-30-13-4-5-14-33(30)27-35/h1-28H/i6D,7D,8D,9D,17D,18D,19D,20D |
| InChIKey | NOIPKHAPKNAQPU-DZBVGMEWSA-N |
| XLogP | 11.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|