C44H28 — CID 58518603
1,2,3,4-tetradeuterio-6,9,10-trinaphthalen-2-ylanthracene (PubChem CID 58518603) has the molecular formula C44H28 and a molecular weight of 560.73 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-6,9,10-trinaphthalen-2-ylanthracene.
| Compound Name | 1,2,3,4-tetradeuterio-6,9,10-trinaphthalen-2-ylanthracene |
|---|---|
| PubChem CID | 58518603 |
| Molecular Formula | C44H28 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 1,2,3,4-tetradeuterio-6,9,10-trinaphthalen-2-ylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccccc4c3)c3cc(-c4ccc5ccccc5c4)ccc3c(-c3ccc4ccccc4c3)c2c1[2H] |
| InChI | InChI=1S/C44H28/c1-4-12-32-25-35(20-17-29(32)9-1)36-23-24-41-42(28-36)44(38-22-19-31-11-3-6-14-34(31)27-38)40-16-8-7-15-39(40)43(41)37-21-18-30-10-2-5-13-33(30)26-37/h1-28H/i7D,8D,15D,16D |
| InChIKey | GRZQCUPEOIVZBR-HLUUBPERSA-N |
| XLogP | 12.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|