C48H30 — CID 162703120
2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]triphenylene (PubChem CID 162703120) has the molecular formula C48H30 and a molecular weight of 614.82 g/mol. Its IUPAC name is 2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]triphenylene.
| Compound Name | 2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]triphenylene |
|---|---|
| PubChem CID | 162703120 |
| Molecular Formula | C48H30 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | 2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]triphenylene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccccc4c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4ccc5c6ccccc6c6ccccc6c5c4)cc3)c2c1[2H] |
| InChI | InChI=1S/C48H30/c1-2-12-34-29-36(26-23-31(34)11-1)48-44-19-9-7-17-42(44)47(43-18-8-10-20-45(43)48)33-24-21-32(22-25-33)35-27-28-41-39-15-4-3-13-37(39)38-14-5-6-16-40(38)46(41)30-35/h1-30H/i7D,8D,9D,10D,17D,18D,19D,20D |
| InChIKey | ALRHKMFFFOONKX-GEHMGHGBSA-N |
| XLogP | 13.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|