C48H28O2 — CID 170688237
6-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene (PubChem CID 170688237) has the molecular formula C48H28O2 and a molecular weight of 644.80 g/mol. Its IUPAC name is 6-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene.
| Compound Name | 6-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 170688237 |
| Molecular Formula | C48H28O2 |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 6-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccccc4c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4ccc5c(c4)oc4ccc6oc7ccccc7c6c45)cc3)c2c1[2H] |
| InChI | InChI=1S/C48H28O2/c1-2-10-32-27-34(22-19-29(32)9-1)46-37-13-5-3-11-35(37)45(36-12-4-6-14-38(36)46)31-20-17-30(18-21-31)33-23-24-40-44(28-33)50-43-26-25-42-47(48(40)43)39-15-7-8-16-41(39)49-42/h1-28H/i3D,4D,5D,6D,11D,12D,13D,14D |
| InChIKey | HTOZZSYHIZDDNV-VOGGJYSRSA-N |
| XLogP | 13.95 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|