C52H32O — CID 167405579
3-naphthalen-2-yl-7-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-2-yl]dibenzofuran (PubChem CID 167405579) has the molecular formula C52H32O and a molecular weight of 685.91 g/mol. Its IUPAC name is 3-naphthalen-2-yl-7-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-2-yl]dibenzofuran.
| Compound Name | 3-naphthalen-2-yl-7-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-2-yl]dibenzofuran |
|---|---|
| PubChem CID | 167405579 |
| Molecular Formula | C52H32O |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.33 |
| IUPAC Name | 3-naphthalen-2-yl-7-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-2-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4cc(-c5ccc6c(c5)oc5cc(-c7ccc8ccccc8c7)ccc56)ccc4c3)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C52H32O/c1-2-11-34(12-3-1)51-45-14-6-8-16-47(45)52(48-17-9-7-15-46(48)51)42-23-22-36-29-38(20-21-39(36)30-42)41-25-27-44-43-26-24-40(31-49(43)53-50(44)32-41)37-19-18-33-10-4-5-13-35(33)28-37/h1-32H/i1D,2D,3D,6D,7D,8D,9D,11D,12D,14D,15D,16D,17D |
| InChIKey | JNFHPFBYVJXYLN-SYCYICNTSA-N |
| XLogP | 14.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|