C30H18O — CID 177271229
3-(1,2,3,4,5,6,7,8,10-nonadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran (PubChem CID 177271229) has the molecular formula C30H18O and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-(1,2,3,4,5,6,7,8,10-nonadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran.
| Compound Name | 3-(1,2,3,4,5,6,7,8,10-nonadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 177271229 |
| Molecular Formula | C30H18O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-(1,2,3,4,5,6,7,8,10-nonadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4c(c3)oc3cc5ccccc5cc34)c3c([2H])c([2H])c([2H])c([2H])c3c([2H])c2c1[2H] |
| InChI | InChI=1S/C30H18O/c1-2-8-20-17-29-27(16-19(20)7-1)26-14-13-23(18-28(26)31-29)30-24-11-5-3-9-21(24)15-22-10-4-6-12-25(22)30/h1-18H/i3D,4D,5D,6D,9D,10D,11D,12D,15D |
| InChIKey | XQHSRDGJXOTIHF-ZFSQGTSMSA-N |
| XLogP | 8.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|