C30H19Br — CID 142716268
10-bromo-9-naphthalen-2-yl-2-(2,3,4,5,6-pentadeuteriophenyl)anthracene (PubChem CID 142716268) has the molecular formula C30H19Br and a molecular weight of 464.42 g/mol. Its IUPAC name is 10-bromo-9-naphthalen-2-yl-2-(2,3,4,5,6-pentadeuteriophenyl)anthracene.
| Compound Name | 10-bromo-9-naphthalen-2-yl-2-(2,3,4,5,6-pentadeuteriophenyl)anthracene |
|---|---|
| PubChem CID | 142716268 |
| Molecular Formula | C30H19Br |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 10-bromo-9-naphthalen-2-yl-2-(2,3,4,5,6-pentadeuteriophenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(Br)c4ccccc4c(-c4ccc5ccccc5c4)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C30H19Br/c31-30-26-13-7-6-12-25(26)29(24-15-14-21-10-4-5-11-22(21)18-24)28-19-23(16-17-27(28)30)20-8-2-1-3-9-20/h1-19H/i1D,2D,3D,8D,9D |
| InChIKey | SCELWNRTCFOXAZ-NWCULCSXSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|