C52H32 — CID 171415202
1-naphthalen-2-yl-6-[2-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]pyrene (PubChem CID 171415202) has the molecular formula C52H32 and a molecular weight of 661.86 g/mol. Its IUPAC name is 1-naphthalen-2-yl-6-[2-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]pyrene.
| Compound Name | 1-naphthalen-2-yl-6-[2-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]pyrene |
|---|---|
| PubChem CID | 171415202 |
| Molecular Formula | C52H32 |
| Molecular Weight | 661.86 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | 1-naphthalen-2-yl-6-[2-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]pyrene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-c4ccccc4)c4ccccc4c(-c4ccc5ccc6c(-c7ccc8ccccc8c7)ccc7ccc4c5c76)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C52H32/c1-3-11-33(12-4-1)39-25-30-47-48(32-39)52(43-18-10-9-17-42(43)49(47)35-14-5-2-6-15-35)46-29-24-37-22-27-44-41(26-21-36-23-28-45(46)51(37)50(36)44)40-20-19-34-13-7-8-16-38(34)31-40/h1-32H/i1D,3D,4D,11D,12D |
| InChIKey | NUFXYEZGJNLOAZ-KTRFVSTQSA-N |
| XLogP | 14.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.86 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|