C46H28 — CID 177071851
7-(2,3,4,5,6-pentadeuteriophenyl)-12-(6-phenylpyren-1-yl)benzo[a]anthracene (PubChem CID 177071851) has the molecular formula C46H28 and a molecular weight of 585.76 g/mol. Its IUPAC name is 7-(2,3,4,5,6-pentadeuteriophenyl)-12-(6-phenylpyren-1-yl)benzo[a]anthracene.
| Compound Name | 7-(2,3,4,5,6-pentadeuteriophenyl)-12-(6-phenylpyren-1-yl)benzo[a]anthracene |
|---|---|
| PubChem CID | 177071851 |
| Molecular Formula | C46H28 |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 7-(2,3,4,5,6-pentadeuteriophenyl)-12-(6-phenylpyren-1-yl)benzo[a]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3ccc4ccc5c(-c6ccccc6)ccc6ccc3c4c65)c3c2ccc2ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H28/c1-3-11-29(12-4-1)34-24-20-32-22-26-39-40(27-23-33-21-25-38(34)43(32)44(33)39)46-37-18-10-9-17-36(37)42(31-14-5-2-6-15-31)41-28-19-30-13-7-8-16-35(30)45(41)46/h1-28H/i2D,5D,6D,14D,15D |
| InChIKey | JPZPZYZADUYJBE-HZYQAWBHSA-N |
| XLogP | 13.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|