C41H25N — CID 88868980
2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-5-pyren-1-ylpyridine (PubChem CID 88868980) has the molecular formula C41H25N and a molecular weight of 536.69 g/mol. Its IUPAC name is 2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-5-pyren-1-ylpyridine.
| Compound Name | 2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-5-pyren-1-ylpyridine |
|---|---|
| PubChem CID | 88868980 |
| Molecular Formula | C41H25N |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-5-pyren-1-ylpyridine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3ccc(-c4ccc5ccc6cccc7ccc4c5c67)cn3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C41H25N/c1-2-9-26(10-3-1)39-32-13-4-6-15-34(32)41(35-16-7-5-14-33(35)39)37-24-21-30(25-42-37)31-22-19-29-18-17-27-11-8-12-28-20-23-36(31)40(29)38(27)28/h1-25H/i1D,2D,3D,9D,10D |
| InChIKey | MFGJTVFIXYKTDJ-MYWHSQMISA-N |
| XLogP | 11.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|