C44H28 — CID 170778671
1-(3-naphthalen-2-ylphenyl)-6-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene (PubChem CID 170778671) has the molecular formula C44H28 and a molecular weight of 561.74 g/mol. Its IUPAC name is 1-(3-naphthalen-2-ylphenyl)-6-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene.
| Compound Name | 1-(3-naphthalen-2-ylphenyl)-6-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene |
|---|---|
| PubChem CID | 170778671 |
| Molecular Formula | C44H28 |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 1-(3-naphthalen-2-ylphenyl)-6-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3ccc4ccc5c(-c6cccc(-c7ccc8ccccc8c7)c6)ccc6ccc3c4c65)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C44H28/c1-2-8-29(9-3-1)34-12-6-14-37(27-34)39-22-18-31-21-25-42-40(23-19-32-20-24-41(39)43(31)44(32)42)38-15-7-13-35(28-38)36-17-16-30-10-4-5-11-33(30)26-36/h1-28H/i1D,2D,3D,8D,9D |
| InChIKey | SHDZNALQYKLURG-NWCULCSXSA-N |
| XLogP | 12.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|