C60H36 — CID 166019616
1-[3-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(3-pyren-1-ylphenyl)phenyl]phenyl]pyrene (PubChem CID 166019616) has the molecular formula C60H36 and a molecular weight of 763.99 g/mol. Its IUPAC name is 1-[3-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(3-pyren-1-ylphenyl)phenyl]phenyl]pyrene.
| Compound Name | 1-[3-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(3-pyren-1-ylphenyl)phenyl]phenyl]pyrene |
|---|---|
| PubChem CID | 166019616 |
| Molecular Formula | C60H36 |
| Molecular Weight | 763.99 g/mol |
| Exact Mass | 763.33 |
| IUPAC Name | 1-[3-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-5-(3-pyren-1-ylphenyl)phenyl]phenyl]pyrene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc(-c4cccc(-c5ccc6ccc7cccc8ccc5c6c78)c4)cc(-c4cccc(-c5ccc6ccc7cccc8ccc5c6c78)c4)c3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C60H36/c1-2-18-51-37(8-1)9-7-19-52(51)50-35-48(44-14-5-16-46(32-44)53-28-24-42-22-20-38-10-3-12-40-26-30-55(53)59(42)57(38)40)34-49(36-50)45-15-6-17-47(33-45)54-29-25-43-23-21-39-11-4-13-41-27-31-56(54)60(43)58(39)41/h1-36H/i1D,2D,7D,8D,9D,18D,19D |
| InChIKey | NTWCQAMPUQFTIU-IGVLSAMTSA-N |
| XLogP | 16.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.99 |
| LogP ≤ 5 | 16.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|