C56H32O — CID 166019663
1,2,3,4,6,7,9-heptadeuterio-8-[3-pyren-1-yl-5-(4-pyren-1-ylphenyl)phenyl]dibenzofuran (PubChem CID 166019663) has the molecular formula C56H32O and a molecular weight of 727.91 g/mol. Its IUPAC name is 1,2,3,4,6,7,9-heptadeuterio-8-[3-pyren-1-yl-5-(4-pyren-1-ylphenyl)phenyl]dibenzofuran.
| Compound Name | 1,2,3,4,6,7,9-heptadeuterio-8-[3-pyren-1-yl-5-(4-pyren-1-ylphenyl)phenyl]dibenzofuran |
|---|---|
| PubChem CID | 166019663 |
| Molecular Formula | C56H32O |
| Molecular Weight | 727.91 g/mol |
| Exact Mass | 727.29 |
| IUPAC Name | 1,2,3,4,6,7,9-heptadeuterio-8-[3-pyren-1-yl-5-(4-pyren-1-ylphenyl)phenyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c(-c4cc(-c5ccc(-c6ccc7ccc8cccc9ccc6c7c89)cc5)cc(-c5ccc6ccc7cccc8ccc5c6c78)c4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C56H32O/c1-2-10-51-47(9-1)50-32-41(23-28-52(50)57-51)43-29-42(30-44(31-43)46-25-20-40-18-16-36-6-4-8-38-22-27-49(46)56(40)54(36)38)33-11-13-34(14-12-33)45-24-19-39-17-15-35-5-3-7-37-21-26-48(45)55(39)53(35)37/h1-32H/i1D,2D,9D,10D,23D,28D,32D |
| InChIKey | PXHGUMZIOMTORV-CRRPZAEBSA-N |
| XLogP | 16.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.91 |
| LogP ≤ 5 | 16.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|