C34H20O — CID 170657960
7-(2,3,4,5,6-pentadeuteriophenyl)-1-pyren-1-yldibenzofuran (PubChem CID 170657960) has the molecular formula C34H20O and a molecular weight of 449.56 g/mol. Its IUPAC name is 7-(2,3,4,5,6-pentadeuteriophenyl)-1-pyren-1-yldibenzofuran.
| Compound Name | 7-(2,3,4,5,6-pentadeuteriophenyl)-1-pyren-1-yldibenzofuran |
|---|---|
| PubChem CID | 170657960 |
| Molecular Formula | C34H20O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 7-(2,3,4,5,6-pentadeuteriophenyl)-1-pyren-1-yldibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)oc2cccc(-c4ccc5ccc6cccc7ccc4c5c67)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C34H20O/c1-2-6-21(7-3-1)25-16-19-29-31(20-25)35-30-11-5-10-27(34(29)30)26-17-14-24-13-12-22-8-4-9-23-15-18-28(26)33(24)32(22)23/h1-20H/i1D,2D,3D,6D,7D |
| InChIKey | UNRIDBJZEDBMFM-FSTBWYLISA-N |
| XLogP | 9.82 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|