C44H26O — CID 170657951
1-(6-naphthalen-1-ylpyren-1-yl)-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran (PubChem CID 170657951) has the molecular formula C44H26O and a molecular weight of 575.72 g/mol. Its IUPAC name is 1-(6-naphthalen-1-ylpyren-1-yl)-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran.
| Compound Name | 1-(6-naphthalen-1-ylpyren-1-yl)-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
|---|---|
| PubChem CID | 170657951 |
| Molecular Formula | C44H26O |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 1-(6-naphthalen-1-ylpyren-1-yl)-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)oc2cccc(-c4ccc5ccc6c(-c7cccc8ccccc78)ccc7ccc4c5c76)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C44H26O/c1-2-8-27(9-3-1)31-20-25-39-41(26-31)45-40-15-7-14-36(44(39)40)35-22-17-30-18-23-37-34(21-16-29-19-24-38(35)43(30)42(29)37)33-13-6-11-28-10-4-5-12-32(28)33/h1-26H/i1D,2D,3D,8D,9D |
| InChIKey | PUTRSXLEDLTPRC-NWCULCSXSA-N |
| XLogP | 12.64 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|