C52H32O — CID 167406489
7-[2,3,5,6,7,8-hexadeuterio-4-(10-phenylanthracen-9-yl)naphthalen-1-yl]-1-naphthalen-1-yldibenzofuran (PubChem CID 167406489) has the molecular formula C52H32O and a molecular weight of 678.86 g/mol. Its IUPAC name is 7-[2,3,5,6,7,8-hexadeuterio-4-(10-phenylanthracen-9-yl)naphthalen-1-yl]-1-naphthalen-1-yldibenzofuran.
| Compound Name | 7-[2,3,5,6,7,8-hexadeuterio-4-(10-phenylanthracen-9-yl)naphthalen-1-yl]-1-naphthalen-1-yldibenzofuran |
|---|---|
| PubChem CID | 167406489 |
| Molecular Formula | C52H32O |
| Molecular Weight | 678.86 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | 7-[2,3,5,6,7,8-hexadeuterio-4-(10-phenylanthracen-9-yl)naphthalen-1-yl]-1-naphthalen-1-yldibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4ccccc4c(-c4ccccc4)c4ccccc34)c([2H])c([2H])c(-c3ccc4c(c3)oc3cccc(-c5cccc6ccccc56)c34)c2c1[2H] |
| InChI | InChI=1S/C52H32O/c1-2-15-34(16-3-1)50-42-21-8-10-23-44(42)51(45-24-11-9-22-43(45)50)46-31-30-37(38-19-6-7-20-40(38)46)35-28-29-47-49(32-35)53-48-27-13-26-41(52(47)48)39-25-12-17-33-14-4-5-18-36(33)39/h1-32H/i6D,7D,19D,20D,30D,31D |
| InChIKey | ADBGGEDEXVZVSC-KSMOCLSGSA-N |
| XLogP | 14.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.86 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|