C48H30O — CID 170662721
7-phenyl-1-[10-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]anthracen-9-yl]dibenzofuran (PubChem CID 170662721) has the molecular formula C48H30O and a molecular weight of 633.83 g/mol. Its IUPAC name is 7-phenyl-1-[10-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]anthracen-9-yl]dibenzofuran.
| Compound Name | 7-phenyl-1-[10-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 170662721 |
| Molecular Formula | C48H30O |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | 7-phenyl-1-[10-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c(-c2c3ccccc3c(-c3cccc4oc5cc(-c6ccccc6)ccc5c34)c3ccccc23)c([2H])c(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c1[2H] |
| InChI | InChI=1S/C48H30O/c1-2-13-31(14-3-1)33-27-28-42-45(30-33)49-44-26-12-25-43(48(42)44)47-40-22-8-6-20-38(40)46(39-21-7-9-23-41(39)47)35-18-10-17-34(29-35)37-24-11-16-32-15-4-5-19-36(32)37/h1-30H/i4D,5D,10D,11D,15D,16D,17D,18D,19D,24D,29D |
| InChIKey | BHYAEFBVVNKKOF-UFTBEIEESA-N |
| XLogP | 13.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|