C50H32O — CID 170662053
1-[10-[3,4-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]-7-phenyldibenzofuran (PubChem CID 170662053) has the molecular formula C50H32O and a molecular weight of 658.87 g/mol. Its IUPAC name is 1-[10-[3,4-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]-7-phenyldibenzofuran.
| Compound Name | 1-[10-[3,4-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]-7-phenyldibenzofuran |
|---|---|
| PubChem CID | 170662053 |
| Molecular Formula | C50H32O |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | 1-[10-[3,4-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]-7-phenyldibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3c4ccccc4c(-c4cccc5oc6cc(-c7ccccc7)ccc6c45)c4ccccc34)cc2-c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C50H32O/c1-4-15-33(16-5-1)36-27-30-43-47(32-36)51-46-26-14-25-44(50(43)46)49-41-23-12-10-21-39(41)48(40-22-11-13-24-42(40)49)37-28-29-38(34-17-6-2-7-18-34)45(31-37)35-19-8-3-9-20-35/h1-32H/i2D,3D,6D,7D,8D,9D,17D,18D,19D,20D |
| InChIKey | SAYIHUKFBYNNIT-DOQMSTGXSA-N |
| XLogP | 14.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|