C44H28O — CID 170664333
7-(2,3,4,5,6-pentadeuteriophenyl)-1-[10-(2,3,4,5-tetradeuterio-6-phenylphenyl)anthracen-9-yl]dibenzofuran (PubChem CID 170664333) has the molecular formula C44H28O and a molecular weight of 581.76 g/mol. Its IUPAC name is 7-(2,3,4,5,6-pentadeuteriophenyl)-1-[10-(2,3,4,5-tetradeuterio-6-phenylphenyl)anthracen-9-yl]dibenzofuran.
| Compound Name | 7-(2,3,4,5,6-pentadeuteriophenyl)-1-[10-(2,3,4,5-tetradeuterio-6-phenylphenyl)anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 170664333 |
| Molecular Formula | C44H28O |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 7-(2,3,4,5,6-pentadeuteriophenyl)-1-[10-(2,3,4,5-tetradeuterio-6-phenylphenyl)anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)oc2cccc(-c4c5ccccc5c(-c5c([2H])c([2H])c([2H])c([2H])c5-c5ccccc5)c5ccccc45)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C44H28O/c1-3-14-29(15-4-1)31-26-27-38-41(28-31)45-40-25-13-24-39(44(38)40)43-36-22-11-9-20-34(36)42(35-21-10-12-23-37(35)43)33-19-8-7-18-32(33)30-16-5-2-6-17-30/h1-28H/i1D,3D,4D,7D,8D,14D,15D,18D,19D |
| InChIKey | KWJJGHOTCNSKJG-FPKBKXGOSA-N |
| XLogP | 12.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|