C44H26O — CID 170658135
1-[6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)pyren-1-yl]-7-phenyldibenzofuran (PubChem CID 170658135) has the molecular formula C44H26O and a molecular weight of 577.73 g/mol. Its IUPAC name is 1-[6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)pyren-1-yl]-7-phenyldibenzofuran.
| Compound Name | 1-[6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)pyren-1-yl]-7-phenyldibenzofuran |
|---|---|
| PubChem CID | 170658135 |
| Molecular Formula | C44H26O |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 1-[6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)pyren-1-yl]-7-phenyldibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3ccc4ccc5c(-c6cccc7oc8cc(-c9ccccc9)ccc8c67)ccc6ccc3c4c65)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C44H26O/c1-2-7-27(8-3-1)32-19-24-39-41(26-32)45-40-12-6-11-36(44(39)40)35-21-16-30-17-22-37-34(20-15-29-18-23-38(35)43(30)42(29)37)33-14-13-28-9-4-5-10-31(28)25-33/h1-26H/i4D,5D,9D,10D,13D,14D,25D |
| InChIKey | VXSKDXFNHQETPQ-YKUOSIDASA-N |
| XLogP | 12.64 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|