C18H12O2 — CID 156890421
7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-ol (PubChem CID 156890421) has the molecular formula C18H12O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-ol.
| Compound Name | 7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-ol |
|---|---|
| PubChem CID | 156890421 |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-ol |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)oc2cccc(O)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C18H12O2/c19-15-7-4-8-16-18(15)14-10-9-13(11-17(14)20-16)12-5-2-1-3-6-12/h1-11,19H/i1D,2D,3D,5D,6D |
| InChIKey | QKRYILGQFPARIJ-XFEWCBMOSA-N |
| XLogP | 4.96 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |