C44H26 — CID 170668025
1-[2,4,6-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-5-pyren-1-ylphenyl]pyrene (PubChem CID 170668025) has the molecular formula C44H26 and a molecular weight of 562.74 g/mol. Its IUPAC name is 1-[2,4,6-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-5-pyren-1-ylphenyl]pyrene.
| Compound Name | 1-[2,4,6-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-5-pyren-1-ylphenyl]pyrene |
|---|---|
| PubChem CID | 170668025 |
| Molecular Formula | C44H26 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 1-[2,4,6-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-5-pyren-1-ylphenyl]pyrene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c(-c3ccc4ccc5cccc6ccc3c4c56)c([2H])c(-c3ccc4ccc5cccc6ccc3c4c56)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C44H26/c1-2-6-27(7-3-1)34-24-35(37-20-16-32-14-12-28-8-4-10-30-18-22-39(37)43(32)41(28)30)26-36(25-34)38-21-17-33-15-13-29-9-5-11-31-19-23-40(38)44(33)42(29)31/h1-26H/i1D,2D,3D,6D,7D,24D,25D,26D |
| InChIKey | DYGOCUHVNSPTNG-KMIPXKCMSA-N |
| XLogP | 12.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|